C10H3F3N2 — CID 82241514
6,7,8-trifluoroquinoline-2-carbonitrile (PubChem CID 82241514) has the molecular formula C10H3F3N2 and a molecular weight of 208.14 g/mol. Its IUPAC name is 6,7,8-trifluoroquinoline-2-carbonitrile.
| Compound Name | 6,7,8-trifluoroquinoline-2-carbonitrile |
|---|---|
| PubChem CID | 82241514 |
| Molecular Formula | C10H3F3N2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 6,7,8-trifluoroquinoline-2-carbonitrile |
| SMILES | N#Cc1ccc2cc(F)c(F)c(F)c2n1 |
| InChI | InChI=1S/C10H3F3N2/c11-7-3-5-1-2-6(4-14)15-10(5)9(13)8(7)12/h1-3H |
| InChIKey | VHCVYMZIJDJXDZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|