C13H27N3O — CID 82243837
4-[3-(7-methyl-1,4-diazepan-1-yl)propyl]morpholine (PubChem CID 82243837) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-[3-(7-methyl-1,4-diazepan-1-yl)propyl]morpholine.
| Compound Name | 4-[3-(7-methyl-1,4-diazepan-1-yl)propyl]morpholine |
|---|---|
| PubChem CID | 82243837 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 4-[3-(7-methyl-1,4-diazepan-1-yl)propyl]morpholine |
| SMILES | CC1CCNCCN1CCCN1CCOCC1 |
| InChI | InChI=1S/C13H27N3O/c1-13-3-4-14-5-8-16(13)7-2-6-15-9-11-17-12-10-15/h13-14H,2-12H2,1H3 |
| InChIKey | WFLUXXRKLOHVEJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |