About 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine
4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine (PubChem CID 82242594) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine |
| PubChem CID | 82242594 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine |
| SMILES | CC1CNCCCN1CCN1CCOCC1 |
| InChI | InChI=1S/C12H25N3O/c1-12-11-13-3-2-4-15(12)6-5-14-7-9-16-10-8-14/h12-13H,2-11H2,1H3 |
| InChIKey | XKHUQVXQYWFXQN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine?
The IUPAC name of 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine (CID 82242594) is 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine.
What is the SMILES notation for 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine?
The canonical SMILES for 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine is CC1CNCCCN1CCN1CCOCC1.
What is the InChIKey of 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine?
The InChIKey is XKHUQVXQYWFXQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O/c1-12-11-13-3-2-4-15(12)6-5-14-7-9-16-10-8-14/h12-13H,2-11H2,1H3.
What are the key properties of 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine?
4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine has a molecular weight of 227.35 g/mol, XLogP of 0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-methyl-1,4-diazepan-1-yl)ethyl]morpholine is sourced from PubChem (CID 82242594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).