C14H19FN2O — CID 82244872
2-(4-fluorophenyl)-1-(2-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 82244872) has the molecular formula C14H19FN2O and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(2-methyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-(2-methyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 82244872 |
| Molecular Formula | C14H19FN2O |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(2-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CC1CNCCCN1C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O/c1-11-10-16-7-2-8-17(11)14(18)9-12-3-5-13(15)6-4-12/h3-6,11,16H,2,7-10H2,1H3 |
| InChIKey | BPNOCTFRDKDTOF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |