C8H17ClN2OS — CID 167620909
2-chloro-1-[(2S)-2-methyl-1,4-diazepan-1-yl]ethanone;sulfane (PubChem CID 167620909) has the molecular formula C8H17ClN2OS and a molecular weight of 224.76 g/mol. Its IUPAC name is 2-chloro-1-[(2S)-2-methyl-1,4-diazepan-1-yl]ethanone;sulfane.
| Compound Name | 2-chloro-1-[(2S)-2-methyl-1,4-diazepan-1-yl]ethanone;sulfane |
|---|---|
| PubChem CID | 167620909 |
| Molecular Formula | C8H17ClN2OS |
| Molecular Weight | 224.76 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-chloro-1-[(2S)-2-methyl-1,4-diazepan-1-yl]ethanone;sulfane |
| SMILES | C[C@H]1CNCCCN1C(=O)CCl.S |
| InChI | InChI=1S/C8H15ClN2O.H2S/c1-7-6-10-3-2-4-11(7)8(12)5-9;/h7,10H,2-6H2,1H3;1H2/t7-;/m0./s1 |
| InChIKey | MKQPAGHHESODHS-FJXQXJEOSA-N |
| XLogP | 0.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.76 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|