C10H19ClN2O — CID 130698596
2-chloro-1-(4-ethyl-2-methyl-1,4-diazepan-1-yl)ethanone (PubChem CID 130698596) has the molecular formula C10H19ClN2O and a molecular weight of 218.73 g/mol. Its IUPAC name is 2-chloro-1-(4-ethyl-2-methyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 2-chloro-1-(4-ethyl-2-methyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 130698596 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-chloro-1-(4-ethyl-2-methyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CCN1CCCN(C(=O)CCl)C(C)C1 |
| InChI | InChI=1S/C10H19ClN2O/c1-3-12-5-4-6-13(9(2)8-12)10(14)7-11/h9H,3-8H2,1-2H3 |
| InChIKey | UFQFAISRTFJPPA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|