C10H20N2O — CID 130648670
2-(4-ethyl-2-methyl-1,4-diazepan-1-yl)acetaldehyde (PubChem CID 130648670) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(4-ethyl-2-methyl-1,4-diazepan-1-yl)acetaldehyde.
| Compound Name | 2-(4-ethyl-2-methyl-1,4-diazepan-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 130648670 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-(4-ethyl-2-methyl-1,4-diazepan-1-yl)acetaldehyde |
| SMILES | CCN1CCCN(CC=O)C(C)C1 |
| InChI | InChI=1S/C10H20N2O/c1-3-11-5-4-6-12(7-8-13)10(2)9-11/h8,10H,3-7,9H2,1-2H3 |
| InChIKey | TULHTKZGQWIEJM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|