C15H28N2O — CID 82245084
3-cyclohexyl-1-(2-methyl-1,4-diazepan-1-yl)propan-1-one (PubChem CID 82245084) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2-methyl-1,4-diazepan-1-yl)propan-1-one.
| Compound Name | 3-cyclohexyl-1-(2-methyl-1,4-diazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 82245084 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 3-cyclohexyl-1-(2-methyl-1,4-diazepan-1-yl)propan-1-one |
| SMILES | CC1CNCCCN1C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C15H28N2O/c1-13-12-16-10-5-11-17(13)15(18)9-8-14-6-3-2-4-7-14/h13-14,16H,2-12H2,1H3 |
| InChIKey | MQTJRJCYIQBSBI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |