C14H22N2O2 — CID 82244905
[1-(2-phenoxyethyl)-1,4-diazepan-2-yl]methanol (PubChem CID 82244905) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [1-(2-phenoxyethyl)-1,4-diazepan-2-yl]methanol.
| Compound Name | [1-(2-phenoxyethyl)-1,4-diazepan-2-yl]methanol |
|---|---|
| PubChem CID | 82244905 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [1-(2-phenoxyethyl)-1,4-diazepan-2-yl]methanol |
| SMILES | OCC1CNCCCN1CCOc1ccccc1 |
| InChI | InChI=1S/C14H22N2O2/c17-12-13-11-15-7-4-8-16(13)9-10-18-14-5-2-1-3-6-14/h1-3,5-6,13,15,17H,4,7-12H2 |
| InChIKey | TVFITGDYMQKHAR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |