C13H24N2O3 — CID 82245518
[2-(hydroxymethyl)-5-propan-2-ylpiperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 82245518) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is [2-(hydroxymethyl)-5-propan-2-ylpiperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [2-(hydroxymethyl)-5-propan-2-ylpiperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 82245518 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | [2-(hydroxymethyl)-5-propan-2-ylpiperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | CC(C)C1CN(C(=O)C2CCCO2)C(CO)CN1 |
| InChI | InChI=1S/C13H24N2O3/c1-9(2)11-7-15(10(8-16)6-14-11)13(17)12-4-3-5-18-12/h9-12,14,16H,3-8H2,1-2H3 |
| InChIKey | YIIZIPRTIQROHV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |