C16H22N2O — CID 82245681
2-[2-(cyclopentyloxymethyl)phenyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 82245681) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[2-(cyclopentyloxymethyl)phenyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[2-(cyclopentyloxymethyl)phenyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 82245681 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-[2-(cyclopentyloxymethyl)phenyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | c1ccc(C2=NCCCN2)c(COC2CCCC2)c1 |
| InChI | InChI=1S/C16H22N2O/c1-4-9-15(16-17-10-5-11-18-16)13(6-1)12-19-14-7-2-3-8-14/h1,4,6,9,14H,2-3,5,7-8,10-12H2,(H,17,18) |
| InChIKey | IPTFRMYVSLLUHM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |