About 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea
3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea (PubChem CID 82245950) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea |
| PubChem CID | 82245950 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(C2=NCCN2)cc1 |
| InChI | InChI=1S/C14H20N4O/c1-3-18(4-2)14(19)17-12-7-5-11(6-8-12)13-15-9-10-16-13/h5-8H,3-4,9-10H2,1-2H3,(H,15,16)(H,17,19) |
| InChIKey | GASSBRGPEGMNIJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea?
The IUPAC name of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea (CID 82245950) is 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea.
What is the SMILES notation for 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea?
The canonical SMILES for 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea is CCN(CC)C(=O)Nc1ccc(C2=NCCN2)cc1.
What is the InChIKey of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea?
The InChIKey is GASSBRGPEGMNIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O/c1-3-18(4-2)14(19)17-12-7-5-11(6-8-12)13-15-9-10-16-13/h5-8H,3-4,9-10H2,1-2H3,(H,15,16)(H,17,19).
What are the key properties of 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea?
3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea has a molecular weight of 260.34 g/mol, XLogP of 1.91, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,1-diethylurea is sourced from PubChem (CID 82245950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).