C14H16Cl2O2 — CID 82250027
2-[2-(2,5-dichlorophenyl)cyclohexyl]acetic acid (PubChem CID 82250027) has the molecular formula C14H16Cl2O2 and a molecular weight of 287.19 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)cyclohexyl]acetic acid.
| Compound Name | 2-[2-(2,5-dichlorophenyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 82250027 |
| Molecular Formula | C14H16Cl2O2 |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1CCCCC1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H16Cl2O2/c15-10-5-6-13(16)12(8-10)11-4-2-1-3-9(11)7-14(17)18/h5-6,8-9,11H,1-4,7H2,(H,17,18) |
| InChIKey | GTBOOONJUVSEKD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |