C16H16FNO3 — CID 82250433
2-(1-cyclopentyl-7-fluoro-4-oxoquinolin-2-yl)acetic acid (PubChem CID 82250433) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-(1-cyclopentyl-7-fluoro-4-oxoquinolin-2-yl)acetic acid.
| Compound Name | 2-(1-cyclopentyl-7-fluoro-4-oxoquinolin-2-yl)acetic acid |
|---|---|
| PubChem CID | 82250433 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(1-cyclopentyl-7-fluoro-4-oxoquinolin-2-yl)acetic acid |
| SMILES | O=C(O)Cc1cc(=O)c2ccc(F)cc2n1C1CCCC1 |
| InChI | InChI=1S/C16H16FNO3/c17-10-5-6-13-14(7-10)18(11-3-1-2-4-11)12(8-15(13)19)9-16(20)21/h5-8,11H,1-4,9H2,(H,20,21) |
| InChIKey | HKFFHOHKXHFKID-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |