C17H26N2O2 — CID 82250748
1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2-phenoxyethanone (PubChem CID 82250748) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2-phenoxyethanone.
| Compound Name | 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2-phenoxyethanone |
|---|---|
| PubChem CID | 82250748 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(5,5-dimethyl-2-propan-2-ylpiperazin-1-yl)-2-phenoxyethanone |
| SMILES | CC(C)C1CNC(C)(C)CN1C(=O)COc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-13(2)15-10-18-17(3,4)12-19(15)16(20)11-21-14-8-6-5-7-9-14/h5-9,13,15,18H,10-12H2,1-4H3 |
| InChIKey | MGPNQNGUFPTMRF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |