C15H15F2NO3 — CID 82251464
3-(1-ethyl-5,8-difluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid (PubChem CID 82251464) has the molecular formula C15H15F2NO3 and a molecular weight of 295.28 g/mol. Its IUPAC name is 3-(1-ethyl-5,8-difluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid.
| Compound Name | 3-(1-ethyl-5,8-difluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 82251464 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-(1-ethyl-5,8-difluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid |
| SMILES | CCn1c(C)c(CCC(=O)O)c(=O)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C15H15F2NO3/c1-3-18-8(2)9(4-7-12(19)20)15(21)13-10(16)5-6-11(17)14(13)18/h5-6H,3-4,7H2,1-2H3,(H,19,20) |
| InChIKey | MFXVDRUQVNFJAN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |