C16H14F3NO3 — CID 82240235
3-(1-cyclopropyl-6,7,8-trifluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid (PubChem CID 82240235) has the molecular formula C16H14F3NO3 and a molecular weight of 325.29 g/mol. Its IUPAC name is 3-(1-cyclopropyl-6,7,8-trifluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid.
| Compound Name | 3-(1-cyclopropyl-6,7,8-trifluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 82240235 |
| Molecular Formula | C16H14F3NO3 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-(1-cyclopropyl-6,7,8-trifluoro-2-methyl-4-oxoquinolin-3-yl)propanoic acid |
| SMILES | Cc1c(CCC(=O)O)c(=O)c2cc(F)c(F)c(F)c2n1C1CC1 |
| InChI | InChI=1S/C16H14F3NO3/c1-7-9(4-5-12(21)22)16(23)10-6-11(17)13(18)14(19)15(10)20(7)8-2-3-8/h6,8H,2-5H2,1H3,(H,21,22) |
| InChIKey | TZBGJPWGPPGOAK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|