C15H12F3NO3 — CID 142633412
1-cyclopropyl-2-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 142633412) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is 1-cyclopropyl-2-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-2-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142633412 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-cyclopropyl-2-ethyl-6,7,8-trifluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(=O)c2cc(F)c(F)c(F)c2n1C1CC1 |
| InChI | InChI=1S/C15H12F3NO3/c1-2-9-10(15(21)22)14(20)7-5-8(16)11(17)12(18)13(7)19(9)6-3-4-6/h5-6H,2-4H2,1H3,(H,21,22) |
| InChIKey | AFWYEHAOSYVPDF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|