C16H14BrF2NO3 — CID 66604499
8-(bromomethyl)-1-cyclopropyl-2-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 66604499) has the molecular formula C16H14BrF2NO3 and a molecular weight of 386.19 g/mol. Its IUPAC name is 8-(bromomethyl)-1-cyclopropyl-2-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 8-(bromomethyl)-1-cyclopropyl-2-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 66604499 |
| Molecular Formula | C16H14BrF2NO3 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 8-(bromomethyl)-1-cyclopropyl-2-ethyl-6,7-difluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCc1c(C(=O)O)c(=O)c2cc(F)c(F)c(CBr)c2n1C1CC1 |
| InChI | InChI=1S/C16H14BrF2NO3/c1-2-11-12(16(22)23)15(21)8-5-10(18)13(19)9(6-17)14(8)20(11)7-3-4-7/h5,7H,2-4,6H2,1H3,(H,22,23) |
| InChIKey | UFZTZTNIRITGFV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|