2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid

C13H12INO3 — CID 82252954

IUPAC2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid
SMILESCc1c(CC(=O)O)c(=O)c2cc(I)ccc2n1C
InChIInChI=1S/C13H12INO3/c1-7-9(6-12(16)17)13(18)10-5-8(14)3-4-11(10)15(7)2/h3-5H,6H2,1-2H3,(H,16,17)
InChIKeyCYAYPYDPUBQNTM-UHFFFAOYSA-N
MW357.15 g/mol
LogP2.08
Rot. Bonds2

About 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid

2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid (PubChem CID 82252954) has the molecular formula C13H12INO3 and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid
PubChem CID82252954
Molecular FormulaC13H12INO3
Molecular Weight357.15 g/mol
Exact Mass356.99
IUPAC Name2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid
SMILESCc1c(CC(=O)O)c(=O)c2cc(I)ccc2n1C
InChIInChI=1S/C13H12INO3/c1-7-9(6-12(16)17)13(18)10-5-8(14)3-4-11(10)15(7)2/h3-5H,6H2,1-2H3,(H,16,17)
InChIKeyCYAYPYDPUBQNTM-UHFFFAOYSA-N
XLogP2.08
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500357.15
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid?
The IUPAC name of 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid (CID 82252954) is 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid.
What is the SMILES notation for 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid?
The canonical SMILES for 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid is Cc1c(CC(=O)O)c(=O)c2cc(I)ccc2n1C.
What is the InChIKey of 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid?
The InChIKey is CYAYPYDPUBQNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12INO3/c1-7-9(6-12(16)17)13(18)10-5-8(14)3-4-11(10)15(7)2/h3-5H,6H2,1-2H3,(H,16,17).
What are the key properties of 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid?
2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid has a molecular weight of 357.15 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-iodo-1,2-dimethyl-4-oxoquinolin-3-yl)acetic acid is sourced from PubChem (CID 82252954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).