C12H10INO3 — CID 82252821
6-iodo-1,3-dimethyl-4-oxoquinoline-2-carboxylic acid (PubChem CID 82252821) has the molecular formula C12H10INO3 and a molecular weight of 343.12 g/mol. Its IUPAC name is 6-iodo-1,3-dimethyl-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 6-iodo-1,3-dimethyl-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 82252821 |
| Molecular Formula | C12H10INO3 |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | 6-iodo-1,3-dimethyl-4-oxoquinoline-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)n(C)c2ccc(I)cc2c1=O |
| InChI | InChI=1S/C12H10INO3/c1-6-10(12(16)17)14(2)9-4-3-7(13)5-8(9)11(6)15/h3-5H,1-2H3,(H,16,17) |
| InChIKey | OUMGAXURIQXLBW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|