C13H18Cl2N2 — CID 82255584
1-[1-(2,4-dichlorophenyl)propan-2-yl]piperazine (PubChem CID 82255584) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)propan-2-yl]piperazine.
| Compound Name | 1-[1-(2,4-dichlorophenyl)propan-2-yl]piperazine |
|---|---|
| PubChem CID | 82255584 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)propan-2-yl]piperazine |
| SMILES | CC(Cc1ccc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H18Cl2N2/c1-10(17-6-4-16-5-7-17)8-11-2-3-12(14)9-13(11)15/h2-3,9-10,16H,4-8H2,1H3 |
| InChIKey | XZQBXOOMOYVPAK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |