C14H22N2O2 — CID 82257201
2-[1-(4-aminophenyl)propan-2-ylamino]pentanoic acid (PubChem CID 82257201) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[1-(4-aminophenyl)propan-2-ylamino]pentanoic acid.
| Compound Name | 2-[1-(4-aminophenyl)propan-2-ylamino]pentanoic acid |
|---|---|
| PubChem CID | 82257201 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[1-(4-aminophenyl)propan-2-ylamino]pentanoic acid |
| SMILES | CCCC(NC(C)Cc1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C14H22N2O2/c1-3-4-13(14(17)18)16-10(2)9-11-5-7-12(15)8-6-11/h5-8,10,13,16H,3-4,9,15H2,1-2H3,(H,17,18) |
| InChIKey | WVIUGIYJNMLELA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|