C13H20N2O2 — CID 118910160
(2S,4R)-5-(4-aminophenyl)-2-methyl-4-(methylamino)pentanoic acid (PubChem CID 118910160) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is (2S,4R)-5-(4-aminophenyl)-2-methyl-4-(methylamino)pentanoic acid.
| Compound Name | (2S,4R)-5-(4-aminophenyl)-2-methyl-4-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 118910160 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (2S,4R)-5-(4-aminophenyl)-2-methyl-4-(methylamino)pentanoic acid |
| SMILES | CN[C@@H](Cc1ccc(N)cc1)C[C@H](C)C(=O)O |
| InChI | InChI=1S/C13H20N2O2/c1-9(13(16)17)7-12(15-2)8-10-3-5-11(14)6-4-10/h3-6,9,12,15H,7-8,14H2,1-2H3,(H,16,17)/t9-,12+/m0/s1 |
| InChIKey | PDEGHBDLFDRXSU-JOYOIKCWSA-N |
| XLogP | 1.51 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|