C18H22N2O — CID 82257717
2-phenylmethoxy-5-[2-(prop-2-enylamino)ethyl]aniline (PubChem CID 82257717) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-phenylmethoxy-5-[2-(prop-2-enylamino)ethyl]aniline.
| Compound Name | 2-phenylmethoxy-5-[2-(prop-2-enylamino)ethyl]aniline |
|---|---|
| PubChem CID | 82257717 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-phenylmethoxy-5-[2-(prop-2-enylamino)ethyl]aniline |
| SMILES | C=CCNCCc1ccc(OCc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C18H22N2O/c1-2-11-20-12-10-15-8-9-18(17(19)13-15)21-14-16-6-4-3-5-7-16/h2-9,13,20H,1,10-12,14,19H2 |
| InChIKey | NFFOMRGUVTYCDQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|