C20H28N2O — CID 94759766
5-[3-(2-methylpropylamino)propyl]-2-phenylmethoxyaniline (PubChem CID 94759766) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 5-[3-(2-methylpropylamino)propyl]-2-phenylmethoxyaniline.
| Compound Name | 5-[3-(2-methylpropylamino)propyl]-2-phenylmethoxyaniline |
|---|---|
| PubChem CID | 94759766 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 5-[3-(2-methylpropylamino)propyl]-2-phenylmethoxyaniline |
| SMILES | CC(C)CNCCCc1ccc(OCc2ccccc2)c(N)c1 |
| InChI | InChI=1S/C20H28N2O/c1-16(2)14-22-12-6-9-17-10-11-20(19(21)13-17)23-15-18-7-4-3-5-8-18/h3-5,7-8,10-11,13,16,22H,6,9,12,14-15,21H2,1-2H3 |
| InChIKey | IZKVPVMARWTEQZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|