C19H27N3O — CID 94759809
2-(2-methylpropoxy)-5-[3-(pyridin-4-ylmethylamino)propyl]aniline (PubChem CID 94759809) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 2-(2-methylpropoxy)-5-[3-(pyridin-4-ylmethylamino)propyl]aniline.
| Compound Name | 2-(2-methylpropoxy)-5-[3-(pyridin-4-ylmethylamino)propyl]aniline |
|---|---|
| PubChem CID | 94759809 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 2-(2-methylpropoxy)-5-[3-(pyridin-4-ylmethylamino)propyl]aniline |
| SMILES | CC(C)COc1ccc(CCCNCc2ccncc2)cc1N |
| InChI | InChI=1S/C19H27N3O/c1-15(2)14-23-19-6-5-16(12-18(19)20)4-3-9-22-13-17-7-10-21-11-8-17/h5-8,10-12,15,22H,3-4,9,13-14,20H2,1-2H3 |
| InChIKey | UTKMMHKVGYTORT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|