C19H23FN2O2 — CID 82258509
1-(3-amino-4-ethoxyphenyl)-2-[(2-fluorophenyl)methylamino]butan-1-one (PubChem CID 82258509) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-(3-amino-4-ethoxyphenyl)-2-[(2-fluorophenyl)methylamino]butan-1-one.
| Compound Name | 1-(3-amino-4-ethoxyphenyl)-2-[(2-fluorophenyl)methylamino]butan-1-one |
|---|---|
| PubChem CID | 82258509 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-(3-amino-4-ethoxyphenyl)-2-[(2-fluorophenyl)methylamino]butan-1-one |
| SMILES | CCOc1ccc(C(=O)C(CC)NCc2ccccc2F)cc1N |
| InChI | InChI=1S/C19H23FN2O2/c1-3-17(22-12-14-7-5-6-8-15(14)20)19(23)13-9-10-18(24-4-2)16(21)11-13/h5-11,17,22H,3-4,12,21H2,1-2H3 |
| InChIKey | ZBGHYWFYXGUTGO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|