C21H32N2O4 — CID 82260432
1-[2-[3-ethoxy-4-(pentanoylamino)phenyl]ethyl]piperidine-3-carboxylic acid (PubChem CID 82260432) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[2-[3-ethoxy-4-(pentanoylamino)phenyl]ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[3-ethoxy-4-(pentanoylamino)phenyl]ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 82260432 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-[2-[3-ethoxy-4-(pentanoylamino)phenyl]ethyl]piperidine-3-carboxylic acid |
| SMILES | CCCCC(=O)Nc1ccc(CCN2CCCC(C(=O)O)C2)cc1OCC |
| InChI | InChI=1S/C21H32N2O4/c1-3-5-8-20(24)22-18-10-9-16(14-19(18)27-4-2)11-13-23-12-6-7-17(15-23)21(25)26/h9-10,14,17H,3-8,11-13,15H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | HZCURXQPLZJAMD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |