C20H26N2O2 — CID 82261842
2-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-N-[(2-methoxyphenyl)methyl]ethanamine (PubChem CID 82261842) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-N-[(2-methoxyphenyl)methyl]ethanamine.
| Compound Name | 2-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-N-[(2-methoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 82261842 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-(2,2-dimethyl-3,4-dihydro-1,4-benzoxazin-6-yl)-N-[(2-methoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccccc1CNCCc1ccc2c(c1)NCC(C)(C)O2 |
| InChI | InChI=1S/C20H26N2O2/c1-20(2)14-22-17-12-15(8-9-19(17)24-20)10-11-21-13-16-6-4-5-7-18(16)23-3/h4-9,12,21-22H,10-11,13-14H2,1-3H3 |
| InChIKey | KZXJJQFGXVBQIE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|