C11H17NO — CID 82263415
N,5-dimethyl-2-propoxyaniline (PubChem CID 82263415) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N,5-dimethyl-2-propoxyaniline.
| Compound Name | N,5-dimethyl-2-propoxyaniline |
|---|---|
| PubChem CID | 82263415 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,5-dimethyl-2-propoxyaniline |
| SMILES | CCCOc1ccc(C)cc1NC |
| InChI | InChI=1S/C11H17NO/c1-4-7-13-11-6-5-9(2)8-10(11)12-3/h5-6,8,12H,4,7H2,1-3H3 |
| InChIKey | IJIYAPSKHJCXNI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |