C18H28N2O2 — CID 82264142
1-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-one (PubChem CID 82264142) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-one.
| Compound Name | 1-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 82264142 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-3-piperazin-1-ylpropan-1-one |
| SMILES | CC(CN1CCNCC1)C(=O)c1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C18H28N2O2/c1-13(12-20-9-7-19-8-10-20)17(22)15-11-14(18(2,3)4)5-6-16(15)21/h5-6,11,13,19,21H,7-10,12H2,1-4H3 |
| InChIKey | GILCGGPKASNLMT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |