About 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid
2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid (PubChem CID 82269063) has the molecular formula C11H10ClNO2
and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid |
| PubChem CID | 82269063 |
| Molecular Formula | C11H10ClNO2 |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid |
| SMILES | Cc1cc2[nH]c(Cl)c(C(=O)O)c2cc1C |
| InChI | InChI=1S/C11H10ClNO2/c1-5-3-7-8(4-6(5)2)13-10(12)9(7)11(14)15/h3-4,13H,1-2H3,(H,14,15) |
| InChIKey | VNZLOMZRUSMIJJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid?
The IUPAC name of 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid (CID 82269063) is 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid.
What is the SMILES notation for 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid?
The canonical SMILES for 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid is Cc1cc2[nH]c(Cl)c(C(=O)O)c2cc1C.
What is the InChIKey of 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid?
The InChIKey is VNZLOMZRUSMIJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO2/c1-5-3-7-8(4-6(5)2)13-10(12)9(7)11(14)15/h3-4,13H,1-2H3,(H,14,15).
What are the key properties of 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid?
2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid has a molecular weight of 223.66 g/mol, XLogP of 3.14, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,6-dimethyl-1H-indole-3-carboxylic acid is sourced from PubChem (CID 82269063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).