C10H9Cl2NO — CID 82269694
1-(2,6-dichloro-1H-indol-3-yl)ethanol (PubChem CID 82269694) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is 1-(2,6-dichloro-1H-indol-3-yl)ethanol.
| Compound Name | 1-(2,6-dichloro-1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 82269694 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 1-(2,6-dichloro-1H-indol-3-yl)ethanol |
| SMILES | CC(O)c1c(Cl)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C10H9Cl2NO/c1-5(14)9-7-3-2-6(11)4-8(7)13-10(9)12/h2-5,13-14H,1H3 |
| InChIKey | AOAUOIUGOQAQMJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |