C15H15N3OS — CID 82270058
2-(4-ethoxyphenyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione (PubChem CID 82270058) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione.
| Compound Name | 2-(4-ethoxyphenyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
|---|---|
| PubChem CID | 82270058 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5-methyl-1H-pyrazolo[1,5-a]pyrimidine-7-thione |
| SMILES | CCOc1ccc(-c2cc3nc(C)cc(=S)n3[nH]2)cc1 |
| InChI | InChI=1S/C15H15N3OS/c1-3-19-12-6-4-11(5-7-12)13-9-14-16-10(2)8-15(20)18(14)17-13/h4-9,17H,3H2,1-2H3 |
| InChIKey | HKUJLOMVVIYZJI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|