C26H26ClN5O2S — CID 46253385
4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]-N-(4-ethoxyphenyl)piperidine-1-carbothioamide (PubChem CID 46253385) has the molecular formula C26H26ClN5O2S and a molecular weight of 508.05 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]-N-(4-ethoxyphenyl)piperidine-1-carbothioamide.
| Compound Name | 4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]-N-(4-ethoxyphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 46253385 |
| Molecular Formula | C26H26ClN5O2S |
| Molecular Weight | 508.05 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-7-oxo-1H-pyrazolo[1,5-a]pyrimidin-5-yl]-N-(4-ethoxyphenyl)piperidine-1-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2CCC(c3cc(=O)n4[nH]c(-c5ccc(Cl)cc5)cc4n3)CC2)cc1 |
| InChI | InChI=1S/C26H26ClN5O2S/c1-2-34-21-9-7-20(8-10-21)28-26(35)31-13-11-18(12-14-31)22-16-25(33)32-24(29-22)15-23(30-32)17-3-5-19(27)6-4-17/h3-10,15-16,18,30H,2,11-14H2,1H3,(H,28,35) |
| InChIKey | JEPCTYADOOOILU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.05 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|