C16H17N5O — CID 82270442
[2-(oxolan-2-yl)-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine (PubChem CID 82270442) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is [2-(oxolan-2-yl)-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine.
| Compound Name | [2-(oxolan-2-yl)-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
|---|---|
| PubChem CID | 82270442 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [2-(oxolan-2-yl)-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
| SMILES | NNc1cc(-c2ccccc2)nc2cc(C3CCCO3)nn12 |
| InChI | InChI=1S/C16H17N5O/c17-19-16-9-12(11-5-2-1-3-6-11)18-15-10-13(20-21(15)16)14-7-4-8-22-14/h1-3,5-6,9-10,14,19H,4,7-8,17H2 |
| InChIKey | MWRCMEFESAIORL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|