C15H11F3N4O3 — CID 82273557
5-methyl-3-(4-nitrophenyl)-6-(2,2,2-trifluoroethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 82273557) has the molecular formula C15H11F3N4O3 and a molecular weight of 352.27 g/mol. Its IUPAC name is 5-methyl-3-(4-nitrophenyl)-6-(2,2,2-trifluoroethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-methyl-3-(4-nitrophenyl)-6-(2,2,2-trifluoroethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 82273557 |
| Molecular Formula | C15H11F3N4O3 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-methyl-3-(4-nitrophenyl)-6-(2,2,2-trifluoroethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1nc2c(-c3ccc([N+](=O)[O-])cc3)c[nH]n2c(=O)c1CC(F)(F)F |
| InChI | InChI=1S/C15H11F3N4O3/c1-8-11(6-15(16,17)18)14(23)21-13(20-8)12(7-19-21)9-2-4-10(5-3-9)22(24)25/h2-5,7,19H,6H2,1H3 |
| InChIKey | IYXRGBBOXUWANN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|