C17H26N2 — CID 82276001
2,6,7-trimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 82276001) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2,6,7-trimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2,6,7-trimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82276001 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2,6,7-trimethyl-4-piperidin-1-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc2c(cc1C)C(N1CCCCC1)CC(C)N2 |
| InChI | InChI=1S/C17H26N2/c1-12-9-15-16(10-13(12)2)18-14(3)11-17(15)19-7-5-4-6-8-19/h9-10,14,17-18H,4-8,11H2,1-3H3 |
| InChIKey | KHHMGPBFZIBGPZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |