C16H25N3 — CID 82276002
2,6,7-trimethyl-4-piperazin-1-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 82276002) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2,6,7-trimethyl-4-piperazin-1-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2,6,7-trimethyl-4-piperazin-1-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82276002 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2,6,7-trimethyl-4-piperazin-1-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc2c(cc1C)C(N1CCNCC1)CC(C)N2 |
| InChI | InChI=1S/C16H25N3/c1-11-8-14-15(9-12(11)2)18-13(3)10-16(14)19-6-4-17-5-7-19/h8-9,13,16-18H,4-7,10H2,1-3H3 |
| InChIKey | IACOMQMLEOKMEF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |