C15H19BrN2 — CID 82278169
5-bromo-1,2-dimethyl-3-piperidin-4-ylindole (PubChem CID 82278169) has the molecular formula C15H19BrN2 and a molecular weight of 307.23 g/mol. Its IUPAC name is 5-bromo-1,2-dimethyl-3-piperidin-4-ylindole.
| Compound Name | 5-bromo-1,2-dimethyl-3-piperidin-4-ylindole |
|---|---|
| PubChem CID | 82278169 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-bromo-1,2-dimethyl-3-piperidin-4-ylindole |
| SMILES | Cc1c(C2CCNCC2)c2cc(Br)ccc2n1C |
| InChI | InChI=1S/C15H19BrN2/c1-10-15(11-5-7-17-8-6-11)13-9-12(16)3-4-14(13)18(10)2/h3-4,9,11,17H,5-8H2,1-2H3 |
| InChIKey | OLTLVKIWFSMYRA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|