C20H28BrN3 — CID 51030378
8-bromo-1,3-dimethyl-5-(2-piperidin-4-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 51030378) has the molecular formula C20H28BrN3 and a molecular weight of 390.37 g/mol. Its IUPAC name is 8-bromo-1,3-dimethyl-5-(2-piperidin-4-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-bromo-1,3-dimethyl-5-(2-piperidin-4-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 51030378 |
| Molecular Formula | C20H28BrN3 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 8-bromo-1,3-dimethyl-5-(2-piperidin-4-ylethyl)-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | CC1Cc2c(c3cc(Br)ccc3n2CCC2CCNCC2)C(C)N1 |
| InChI | InChI=1S/C20H28BrN3/c1-13-11-19-20(14(2)23-13)17-12-16(21)3-4-18(17)24(19)10-7-15-5-8-22-9-6-15/h3-4,12-15,22-23H,5-11H2,1-2H3 |
| InChIKey | IJAFBTUCYGNRDB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|