C15H18BrClN2 — CID 178026750
4-bromo-5-chloro-1-(2-piperidin-4-ylethyl)indole (PubChem CID 178026750) has the molecular formula C15H18BrClN2 and a molecular weight of 341.68 g/mol. Its IUPAC name is 4-bromo-5-chloro-1-(2-piperidin-4-ylethyl)indole.
| Compound Name | 4-bromo-5-chloro-1-(2-piperidin-4-ylethyl)indole |
|---|---|
| PubChem CID | 178026750 |
| Molecular Formula | C15H18BrClN2 |
| Molecular Weight | 341.68 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-bromo-5-chloro-1-(2-piperidin-4-ylethyl)indole |
| SMILES | Clc1ccc2c(ccn2CCC2CCNCC2)c1Br |
| InChI | InChI=1S/C15H18BrClN2/c16-15-12-6-10-19(14(12)2-1-13(15)17)9-5-11-3-7-18-8-4-11/h1-2,6,10-11,18H,3-5,7-9H2 |
| InChIKey | FHIYKPLLPASWRB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |