C15H19FN2 — CID 82792919
4-fluoro-1-(2-piperidin-3-ylethyl)indole (PubChem CID 82792919) has the molecular formula C15H19FN2 and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-fluoro-1-(2-piperidin-3-ylethyl)indole.
| Compound Name | 4-fluoro-1-(2-piperidin-3-ylethyl)indole |
|---|---|
| PubChem CID | 82792919 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-fluoro-1-(2-piperidin-3-ylethyl)indole |
| SMILES | Fc1cccc2c1ccn2CCC1CCCNC1 |
| InChI | InChI=1S/C15H19FN2/c16-14-4-1-5-15-13(14)7-10-18(15)9-6-12-3-2-8-17-11-12/h1,4-5,7,10,12,17H,2-3,6,8-9,11H2 |
| InChIKey | RKOACOBQMGHGDJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |