C11H18N2O — CID 82281820
3,3-dimethyl-5-(1-methylpyrrol-3-yl)morpholine (PubChem CID 82281820) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3,3-dimethyl-5-(1-methylpyrrol-3-yl)morpholine.
| Compound Name | 3,3-dimethyl-5-(1-methylpyrrol-3-yl)morpholine |
|---|---|
| PubChem CID | 82281820 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3,3-dimethyl-5-(1-methylpyrrol-3-yl)morpholine |
| SMILES | Cn1ccc(C2COCC(C)(C)N2)c1 |
| InChI | InChI=1S/C11H18N2O/c1-11(2)8-14-7-10(12-11)9-4-5-13(3)6-9/h4-6,10,12H,7-8H2,1-3H3 |
| InChIKey | SLBFSCALDGHLHW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |