C11H19N3O — CID 82283979
2-(1,4-diazepan-1-yl)-2-(1H-pyrrol-3-yl)ethanol (PubChem CID 82283979) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(1H-pyrrol-3-yl)ethanol.
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(1H-pyrrol-3-yl)ethanol |
|---|---|
| PubChem CID | 82283979 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(1H-pyrrol-3-yl)ethanol |
| SMILES | OCC(c1cc[nH]c1)N1CCCNCC1 |
| InChI | InChI=1S/C11H19N3O/c15-9-11(10-2-4-13-8-10)14-6-1-3-12-5-7-14/h2,4,8,11-13,15H,1,3,5-7,9H2 |
| InChIKey | NSPKKOKZYTVAPQ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |