C12H14N2O2 — CID 82285403
2-[4-(2-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine (PubChem CID 82285403) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[4-(2-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine.
| Compound Name | 2-[4-(2-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 82285403 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[4-(2-methoxyphenyl)-1,3-oxazol-2-yl]ethanamine |
| SMILES | COc1ccccc1-c1coc(CCN)n1 |
| InChI | InChI=1S/C12H14N2O2/c1-15-11-5-3-2-4-9(11)10-8-16-12(14-10)6-7-13/h2-5,8H,6-7,13H2,1H3 |
| InChIKey | PJAPAUZKKSXBHV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |