C14H15N3 — CID 82287618
[6-(2,3-dihydro-1H-inden-5-yl)pyridazin-3-yl]methanamine (PubChem CID 82287618) has the molecular formula C14H15N3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [6-(2,3-dihydro-1H-inden-5-yl)pyridazin-3-yl]methanamine.
| Compound Name | [6-(2,3-dihydro-1H-inden-5-yl)pyridazin-3-yl]methanamine |
|---|---|
| PubChem CID | 82287618 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | [6-(2,3-dihydro-1H-inden-5-yl)pyridazin-3-yl]methanamine |
| SMILES | NCc1ccc(-c2ccc3c(c2)CCC3)nn1 |
| InChI | InChI=1S/C14H15N3/c15-9-13-6-7-14(17-16-13)12-5-4-10-2-1-3-11(10)8-12/h4-8H,1-3,9,15H2 |
| InChIKey | BOCZOGFZVHVHRR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |