C14H14N4O — CID 82381300
2-[6-(2,3-dihydro-1H-inden-5-yl)-1,2,4-triazin-3-yl]acetamide (PubChem CID 82381300) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[6-(2,3-dihydro-1H-inden-5-yl)-1,2,4-triazin-3-yl]acetamide.
| Compound Name | 2-[6-(2,3-dihydro-1H-inden-5-yl)-1,2,4-triazin-3-yl]acetamide |
|---|---|
| PubChem CID | 82381300 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[6-(2,3-dihydro-1H-inden-5-yl)-1,2,4-triazin-3-yl]acetamide |
| SMILES | NC(=O)Cc1ncc(-c2ccc3c(c2)CCC3)nn1 |
| InChI | InChI=1S/C14H14N4O/c15-13(19)7-14-16-8-12(17-18-14)11-5-4-9-2-1-3-10(9)6-11/h4-6,8H,1-3,7H2,(H2,15,19) |
| InChIKey | DPFTVFINJOKHNN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |