C17H16N4O2 — CID 82167208
2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]acetic acid (PubChem CID 82167208) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]acetic acid.
| Compound Name | 2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]acetic acid |
|---|---|
| PubChem CID | 82167208 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-[6-(5,6,7,8-tetrahydronaphthalen-2-yl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]acetic acid |
| SMILES | O=C(O)Cc1nnc2ccc(-c3ccc4c(c3)CCCC4)nn12 |
| InChI | InChI=1S/C17H16N4O2/c22-17(23)10-16-19-18-15-8-7-14(20-21(15)16)13-6-5-11-3-1-2-4-12(11)9-13/h5-9H,1-4,10H2,(H,22,23) |
| InChIKey | KXOBQORMANDSKS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |